About azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate
azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate (PubChem CID 178078346) has the molecular formula C6H8F3NO4
and a molecular weight of 215.13 g/mol. Its IUPAC name is azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate.
Molecular Properties
| Compound Name | azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate |
| PubChem CID | 178078346 |
| Molecular Formula | C6H8F3NO4 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate |
| SMILES | CC1=COC(C(=O)[O-])(C(F)(F)F)O1.[NH4+] |
| InChI | InChI=1S/C6H5F3O4.H3N/c1-3-2-12-5(13-3,4(10)11)6(7,8)9;/h2H,1H3,(H,10,11);1H3 |
| InChIKey | JBLRDGSTDMNGGO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate?
The IUPAC name of azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate (CID 178078346) is azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate.
What is the SMILES notation for azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate?
The canonical SMILES for azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate is CC1=COC(C(=O)[O-])(C(F)(F)F)O1.[NH4+].
What is the InChIKey of azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate?
The InChIKey is JBLRDGSTDMNGGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3O4.H3N/c1-3-2-12-5(13-3,4(10)11)6(7,8)9;/h2H,1H3,(H,10,11);1H3.
What are the key properties of azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate?
azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate has a molecular weight of 215.13 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylate is sourced from PubChem (CID 178078346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).