C12H16O3 — CID 178078393
6-(methoxymethoxy)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one (PubChem CID 178078393) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 6-(methoxymethoxy)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one.
| Compound Name | 6-(methoxymethoxy)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 178078393 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 6-(methoxymethoxy)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
| SMILES | COCOC1=CC=C2C(=O)CCCC2C1 |
| InChI | InChI=1S/C12H16O3/c1-14-8-15-10-5-6-11-9(7-10)3-2-4-12(11)13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | GZVWTRUYKAKRMO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|