C23H21F2N5 — CID 178078968
2-(4-fluorophenyl)-6-[[(3S)-3-fluoropiperazin-1-yl]methyl]-3-pyridin-4-ylpyrazolo[1,5-a]pyridine (PubChem CID 178078968) has the molecular formula C23H21F2N5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-[[(3S)-3-fluoropiperazin-1-yl]methyl]-3-pyridin-4-ylpyrazolo[1,5-a]pyridine.
| Compound Name | 2-(4-fluorophenyl)-6-[[(3S)-3-fluoropiperazin-1-yl]methyl]-3-pyridin-4-ylpyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 178078968 |
| Molecular Formula | C23H21F2N5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-(4-fluorophenyl)-6-[[(3S)-3-fluoropiperazin-1-yl]methyl]-3-pyridin-4-ylpyrazolo[1,5-a]pyridine |
| SMILES | Fc1ccc(-c2nn3cc(CN4CCN[C@@H](F)C4)ccc3c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C23H21F2N5/c24-19-4-2-18(3-5-19)23-22(17-7-9-26-10-8-17)20-6-1-16(14-30(20)28-23)13-29-12-11-27-21(25)15-29/h1-10,14,21,27H,11-13,15H2/t21-/m1/s1 |
| InChIKey | YHKFQHILFQRCAM-OAQYLSRUSA-N |
| XLogP | 3.90 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|