C31H33ClN4O2 — CID 178079857
[4-[(3-chlorophenyl)-phenylmethyl]-3-ethylpiperazin-1-yl]-isoquinolin-4-ylmethanone;N-methylformamide (PubChem CID 178079857) has the molecular formula C31H33ClN4O2 and a molecular weight of 529.08 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)-phenylmethyl]-3-ethylpiperazin-1-yl]-isoquinolin-4-ylmethanone;N-methylformamide.
| Compound Name | [4-[(3-chlorophenyl)-phenylmethyl]-3-ethylpiperazin-1-yl]-isoquinolin-4-ylmethanone;N-methylformamide |
|---|---|
| PubChem CID | 178079857 |
| Molecular Formula | C31H33ClN4O2 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | [4-[(3-chlorophenyl)-phenylmethyl]-3-ethylpiperazin-1-yl]-isoquinolin-4-ylmethanone;N-methylformamide |
| SMILES | CCC1CN(C(=O)c2cncc3ccccc23)CCN1C(c1ccccc1)c1cccc(Cl)c1.CNC=O |
| InChI | InChI=1S/C29H28ClN3O.C2H5NO/c1-2-25-20-32(29(34)27-19-31-18-23-11-6-7-14-26(23)27)15-16-33(25)28(21-9-4-3-5-10-21)22-12-8-13-24(30)17-22;1-3-2-4/h3-14,17-19,25,28H,2,15-16,20H2,1H3;2H,1H3,(H,3,4) |
| InChIKey | VMXTYKYIQFUOAY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|