About 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine
7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine (PubChem CID 178080142) has the molecular formula C11H13N3OS
and a molecular weight of 235.31 g/mol. Its IUPAC name is 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine |
| PubChem CID | 178080142 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine |
| SMILES | C=C(OCC)c1c(N)cnc2sc(C)nc12 |
| InChI | InChI=1S/C11H13N3OS/c1-4-15-6(2)9-8(12)5-13-11-10(9)14-7(3)16-11/h5H,2,4,12H2,1,3H3 |
| InChIKey | OPDDIJJJBCYTHE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
The IUPAC name of 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine (CID 178080142) is 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine.
What is the SMILES notation for 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
The canonical SMILES for 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine is C=C(OCC)c1c(N)cnc2sc(C)nc12.
What is the InChIKey of 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
The InChIKey is OPDDIJJJBCYTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3OS/c1-4-15-6(2)9-8(12)5-13-11-10(9)14-7(3)16-11/h5H,2,4,12H2,1,3H3.
What are the key properties of 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine has a molecular weight of 235.31 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-ethoxyethenyl)-2-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine is sourced from PubChem (CID 178080142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).