About 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium
2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium (PubChem CID 178080183) has the molecular formula C7H7N4Re-
and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium.
Molecular Properties
| Compound Name | 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium |
| PubChem CID | 178080183 |
| Molecular Formula | C7H7N4Re- |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium |
| SMILES | Cc1cn2ncc(N)[c-]c2n1.[Re] |
| InChI | InChI=1S/C7H7N4.Re/c1-5-4-11-7(10-5)2-6(8)3-9-11;/h3-4H,8H2,1H3;/q-1; |
| InChIKey | LSOYBKNOCDDXFW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium?
The IUPAC name of 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium (CID 178080183) is 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium.
What is the SMILES notation for 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium?
The canonical SMILES for 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium is Cc1cn2ncc(N)[c-]c2n1.[Re].
What is the InChIKey of 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium?
The InChIKey is LSOYBKNOCDDXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N4.Re/c1-5-4-11-7(10-5)2-6(8)3-9-11;/h3-4H,8H2,1H3;/q-1;.
What are the key properties of 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium?
2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium has a molecular weight of 333.37 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-8H-imidazo[1,2-b]pyridazin-8-id-7-amine;rhenium is sourced from PubChem (CID 178080183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).