C17H31N3O — CID 178080494
5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1H-pyrazine;ethanimine;hexanal (PubChem CID 178080494) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1H-pyrazine;ethanimine;hexanal.
| Compound Name | 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1H-pyrazine;ethanimine;hexanal |
|---|---|
| PubChem CID | 178080494 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 5,6-bis(ethenyl)-4-methyl-2,3-dihydro-1H-pyrazine;ethanimine;hexanal |
| SMILES | C=CC1=C(C=C)N(C)CCN1.CCCCCC=O.[H]/N=C/C |
| InChI | InChI=1S/C9H14N2.C6H12O.C2H5N/c1-4-8-9(5-2)11(3)7-6-10-8;1-2-3-4-5-6-7;1-2-3/h4-5,10H,1-2,6-7H2,3H3;6H,2-5H2,1H3;2-3H,1H3/b;;3-2+ |
| InChIKey | HTTSXRINADYZFY-CITOEQSFSA-N |
| XLogP | 3.53 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|