C15H19FO5S — CID 178081168
(7-fluoro-1,4-dioxaspiro[4.5]decan-8-yl) 4-methylbenzenesulfonate (PubChem CID 178081168) has the molecular formula C15H19FO5S and a molecular weight of 330.38 g/mol. Its IUPAC name is (7-fluoro-1,4-dioxaspiro[4.5]decan-8-yl) 4-methylbenzenesulfonate.
| Compound Name | (7-fluoro-1,4-dioxaspiro[4.5]decan-8-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 178081168 |
| Molecular Formula | C15H19FO5S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (7-fluoro-1,4-dioxaspiro[4.5]decan-8-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3(CC2F)OCCO3)cc1 |
| InChI | InChI=1S/C15H19FO5S/c1-11-2-4-12(5-3-11)22(17,18)21-14-6-7-15(10-13(14)16)19-8-9-20-15/h2-5,13-14H,6-10H2,1H3 |
| InChIKey | NQYZASXASZLHNP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|