C21H21ClN6O3 — CID 178081899
[(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-pent-1-yn-3-ylpiperazine-1-carboxylate (PubChem CID 178081899) has the molecular formula C21H21ClN6O3 and a molecular weight of 440.89 g/mol. Its IUPAC name is [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-pent-1-yn-3-ylpiperazine-1-carboxylate.
| Compound Name | [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-pent-1-yn-3-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 178081899 |
| Molecular Formula | C21H21ClN6O3 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [(7S)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-pent-1-yn-3-ylpiperazine-1-carboxylate |
| SMILES | C#CC(CC)N1CCN(C(=O)O[C@H]2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C21H21ClN6O3/c1-3-15(4-2)26-9-11-27(12-10-26)21(30)31-20-18-17(23-7-8-24-18)19(29)28(20)16-6-5-14(22)13-25-16/h1,5-8,13,15,20H,4,9-12H2,2H3/t15?,20-/m0/s1 |
| InChIKey | DARGECOFZBCMSA-MBABXSBOSA-N |
| XLogP | 2.35 |
| TPSA | 91.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|