C47H54N6O4 — CID 178082066
2-[5-[4-[2-[4-[[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]-3,9-diazaspiro[5.5]undecan-9-yl]methyl]piperidin-1-yl]-2-oxoethyl]phenyl]-2-pyridinyl]-2-phenylacetamide (PubChem CID 178082066) has the molecular formula C47H54N6O4 and a molecular weight of 766.99 g/mol. Its IUPAC name is 2-[5-[4-[2-[4-[[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]-3,9-diazaspiro[5.5]undecan-9-yl]methyl]piperidin-1-yl]-2-oxoethyl]phenyl]-2-pyridinyl]-2-phenylacetamide.
| Compound Name | 2-[5-[4-[2-[4-[[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]-3,9-diazaspiro[5.5]undecan-9-yl]methyl]piperidin-1-yl]-2-oxoethyl]phenyl]-2-pyridinyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 178082066 |
| Molecular Formula | C47H54N6O4 |
| Molecular Weight | 766.99 g/mol |
| Exact Mass | 766.42 |
| IUPAC Name | 2-[5-[4-[2-[4-[[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]-3,9-diazaspiro[5.5]undecan-9-yl]methyl]piperidin-1-yl]-2-oxoethyl]phenyl]-2-pyridinyl]-2-phenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)c1ccc(-c2ccc(CC(=O)N3CCC(CN4CCC5(CC4)CCN(c4ccc(C6CCC(=O)NC6=O)cc4)CC5)CC3)cc2)cn1 |
| InChI | InChI=1S/C47H54N6O4/c48-45(56)44(37-4-2-1-3-5-37)41-16-12-38(31-49-41)35-8-6-33(7-9-35)30-43(55)53-24-18-34(19-25-53)32-51-26-20-47(21-27-51)22-28-52(29-23-47)39-13-10-36(11-14-39)40-15-17-42(54)50-46(40)57/h1-14,16,31,34,40,44H,15,17-30,32H2,(H2,48,56)(H,50,54,57) |
| InChIKey | PQQFVIQYEGVIJD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.99 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|