C23H44N2O4 — CID 178082703
ethane;molecular hydrogen;3-[3-(3-oxobutoxy)propanoyl]-N-propan-2-yl-3-azaspiro[5.5]undecane-9-carboxamide (PubChem CID 178082703) has the molecular formula C23H44N2O4 and a molecular weight of 412.62 g/mol. Its IUPAC name is ethane;molecular hydrogen;3-[3-(3-oxobutoxy)propanoyl]-N-propan-2-yl-3-azaspiro[5.5]undecane-9-carboxamide.
| Compound Name | ethane;molecular hydrogen;3-[3-(3-oxobutoxy)propanoyl]-N-propan-2-yl-3-azaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 178082703 |
| Molecular Formula | C23H44N2O4 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | ethane;molecular hydrogen;3-[3-(3-oxobutoxy)propanoyl]-N-propan-2-yl-3-azaspiro[5.5]undecane-9-carboxamide |
| SMILES | CC.CC(=O)CCOCCC(=O)N1CCC2(CCC(C(=O)NC(C)C)CC2)CC1.[H][H] |
| InChI | InChI=1S/C21H36N2O4.C2H6.H2/c1-16(2)22-20(26)18-4-8-21(9-5-18)10-12-23(13-11-21)19(25)7-15-27-14-6-17(3)24;1-2;/h16,18H,4-15H2,1-3H3,(H,22,26);1-2H3;1H |
| InChIKey | BUCURBMPWQFUPB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|