C27H42N4O3 — CID 178083801
(4S)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide (PubChem CID 178083801) has the molecular formula C27H42N4O3 and a molecular weight of 470.66 g/mol. Its IUPAC name is (4S)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | (4S)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 178083801 |
| Molecular Formula | C27H42N4O3 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | (4S)-1-[(2S)-3,3-dimethyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-4-ethyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2-carboxamide |
| SMILES | CC[C@H]1CC(C(=O)NC2CCCc3ccccc32)N(C(=O)[C@@H](NC(=O)[C@H](C)NC)C(C)(C)C)C1 |
| InChI | InChI=1S/C27H42N4O3/c1-7-18-15-22(25(33)29-21-14-10-12-19-11-8-9-13-20(19)21)31(16-18)26(34)23(27(3,4)5)30-24(32)17(2)28-6/h8-9,11,13,17-18,21-23,28H,7,10,12,14-16H2,1-6H3,(H,29,33)(H,30,32)/t17-,18-,21?,22?,23+/m0/s1 |
| InChIKey | UVTIKCZVHQSWKZ-GXOPUDRZSA-N |
| XLogP | 2.95 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |