C31H36BF5N4O4 — CID 178084400
2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[2-(2,2-difluoroethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 178084400) has the molecular formula C31H36BF5N4O4 and a molecular weight of 634.46 g/mol. Its IUPAC name is 2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[2-(2,2-difluoroethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[2-(2,2-difluoroethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 178084400 |
| Molecular Formula | C31H36BF5N4O4 |
| Molecular Weight | 634.46 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[2-(2,2-difluoroethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1(C)OB(c2ccc(COCC(F)F)c(N3CCC4(CC3)N=C(c3ccc(C(F)(F)F)nc3C3CC3)NC4=O)c2)OC1(C)C |
| InChI | InChI=1S/C31H36BF5N4O4/c1-28(2)29(3,4)45-32(44-28)20-8-7-19(16-43-17-24(33)34)22(15-20)41-13-11-30(12-14-41)27(42)39-26(40-30)21-9-10-23(31(35,36)37)38-25(21)18-5-6-18/h7-10,15,18,24H,5-6,11-14,16-17H2,1-4H3,(H,39,40,42) |
| InChIKey | OTAQUWGHWZTDAY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|