C25H20BrF3N4O3 — CID 178085005
4-bromo-2-[(5R,7S)-2-(4-cyclopropyl-2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]-6-fluorobenzonitrile (PubChem CID 178085005) has the molecular formula C25H20BrF3N4O3 and a molecular weight of 561.36 g/mol. Its IUPAC name is 4-bromo-2-[(5R,7S)-2-(4-cyclopropyl-2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]-6-fluorobenzonitrile.
| Compound Name | 4-bromo-2-[(5R,7S)-2-(4-cyclopropyl-2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 178085005 |
| Molecular Formula | C25H20BrF3N4O3 |
| Molecular Weight | 561.36 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 4-bromo-2-[(5R,7S)-2-(4-cyclopropyl-2,2-difluoro-1,3-benzodioxol-5-yl)-7-methyl-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]-6-fluorobenzonitrile |
| SMILES | C[C@H]1C[C@@]2(CCN1c1cc(Br)cc(F)c1C#N)N=C(c1ccc3c(c1C1CC1)OC(F)(F)O3)NC2=O |
| InChI | InChI=1S/C25H20BrF3N4O3/c1-12-10-24(6-7-33(12)18-9-14(26)8-17(27)16(18)11-30)23(34)31-22(32-24)15-4-5-19-21(20(15)13-2-3-13)36-25(28,29)35-19/h4-5,8-9,12-13H,2-3,6-7,10H2,1H3,(H,31,32,34)/t12-,24+/m0/s1 |
| InChIKey | YZXLVEWTMWDMJZ-FNODVLLQSA-N |
| XLogP | 4.96 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |