About ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate
ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate (PubChem CID 178085525) has the molecular formula C13H21F3O5S
and a molecular weight of 346.37 g/mol. Its IUPAC name is ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate |
| PubChem CID | 178085525 |
| Molecular Formula | C13H21F3O5S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate |
| SMILES | CC.COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CC(C)(C)CC1 |
| InChI | InChI=1S/C11H15F3O5S.C2H6/c1-10(2)5-4-7(9(15)18-3)8(6-10)19-20(16,17)11(12,13)14;1-2/h4-6H2,1-3H3;1-2H3 |
| InChIKey | OUFSWQVJQFZIFR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate?
The IUPAC name of ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate (CID 178085525) is ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate.
What is the SMILES notation for ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate?
The canonical SMILES for ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate is CC.COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CC(C)(C)CC1.
What is the InChIKey of ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate?
The InChIKey is OUFSWQVJQFZIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O5S.C2H6/c1-10(2)5-4-7(9(15)18-3)8(6-10)19-20(16,17)11(12,13)14;1-2/h4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate?
ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate has a molecular weight of 346.37 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4,4-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohexene-1-carboxylate is sourced from PubChem (CID 178085525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).