C15H17F3 — CID 178085633
(3aR,6aS)-6,6-difluoro-3-(4-fluoro-3-methylphenyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene (PubChem CID 178085633) has the molecular formula C15H17F3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (3aR,6aS)-6,6-difluoro-3-(4-fluoro-3-methylphenyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene.
| Compound Name | (3aR,6aS)-6,6-difluoro-3-(4-fluoro-3-methylphenyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 178085633 |
| Molecular Formula | C15H17F3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (3aR,6aS)-6,6-difluoro-3-(4-fluoro-3-methylphenyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
| SMILES | Cc1cc(C2CC[C@H]3[C@@H]2CCC3(F)F)ccc1F |
| InChI | InChI=1S/C15H17F3/c1-9-8-10(2-5-14(9)16)11-3-4-13-12(11)6-7-15(13,17)18/h2,5,8,11-13H,3-4,6-7H2,1H3/t11?,12-,13+/m1/s1 |
| InChIKey | SLNOVDSYPCGXOB-HDYSRYHKSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |