C16H16F4O2 — CID 178085756
3-(3,4-difluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene-2-carboxylic acid (PubChem CID 178085756) has the molecular formula C16H16F4O2 and a molecular weight of 316.29 g/mol. Its IUPAC name is 3-(3,4-difluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene-2-carboxylic acid.
| Compound Name | 3-(3,4-difluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene-2-carboxylic acid |
|---|---|
| PubChem CID | 178085756 |
| Molecular Formula | C16H16F4O2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-(3,4-difluoro-2-methylphenyl)-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| SMILES | Cc1c(C2C(C(=O)O)CC3C2CCC3(F)F)ccc(F)c1F |
| InChI | InChI=1S/C16H16F4O2/c1-7-8(2-3-12(17)14(7)18)13-9-4-5-16(19,20)11(9)6-10(13)15(21)22/h2-3,9-11,13H,4-6H2,1H3,(H,21,22) |
| InChIKey | APDNAYYGTOOCSP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |