About ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole
ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole (PubChem CID 178086762) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole.
Molecular Properties
| Compound Name | ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole |
| PubChem CID | 178086762 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole |
| SMILES | C=Cc1c(/C=C\C)c(C)cn1C.CC |
| InChI | InChI=1S/C11H15N.C2H6/c1-5-7-10-9(3)8-12(4)11(10)6-2;1-2/h5-8H,2H2,1,3-4H3;1-2H3/b7-5-; |
| InChIKey | YMPLYMXOTFFLAZ-YJOCEBFMSA-N |
| XLogP | 4.04 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole?
The IUPAC name of ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole (CID 178086762) is ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole.
What is the SMILES notation for ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole?
The canonical SMILES for ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole is C=Cc1c(/C=C\C)c(C)cn1C.CC.
What is the InChIKey of ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole?
The InChIKey is YMPLYMXOTFFLAZ-YJOCEBFMSA-N. The full InChI is InChI=1S/C11H15N.C2H6/c1-5-7-10-9(3)8-12(4)11(10)6-2;1-2/h5-8H,2H2,1,3-4H3;1-2H3/b7-5-;.
What are the key properties of ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole?
ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole has a molecular weight of 191.32 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethenyl-1,4-dimethyl-3-[(Z)-prop-1-enyl]pyrrole is sourced from PubChem (CID 178086762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).