C16H28FNO3 — CID 178087177
tert-butyl (2R)-2-[(1R)-1-fluoro-1-(oxan-4-yl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 178087177) has the molecular formula C16H28FNO3 and a molecular weight of 301.40 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1R)-1-fluoro-1-(oxan-4-yl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1R)-1-fluoro-1-(oxan-4-yl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178087177 |
| Molecular Formula | C16H28FNO3 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | tert-butyl (2R)-2-[(1R)-1-fluoro-1-(oxan-4-yl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1[C@](C)(F)C1CCOCC1 |
| InChI | InChI=1S/C16H28FNO3/c1-15(2,3)21-14(19)18-9-5-6-13(18)16(4,17)12-7-10-20-11-8-12/h12-13H,5-11H2,1-4H3/t13-,16-/m1/s1 |
| InChIKey | SRXLFIFUACOIGK-CZUORRHYSA-N |
| XLogP | 3.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |