C13H22N2O3 — CID 178087683
methyl 2-(1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl)-3-oxopentanoate (PubChem CID 178087683) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 2-(1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl)-3-oxopentanoate.
| Compound Name | methyl 2-(1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 178087683 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | methyl 2-(1,2,3,3a,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-4-yl)-3-oxopentanoate |
| SMILES | CCC(=O)C(C(=O)OC)N1CCCC2NCCC21 |
| InChI | InChI=1S/C13H22N2O3/c1-3-11(16)12(13(17)18-2)15-8-4-5-9-10(15)6-7-14-9/h9-10,12,14H,3-8H2,1-2H3 |
| InChIKey | NGIUFDSNKXSWTP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|