About 5,5-difluorocycloheptene;ethane
5,5-difluorocycloheptene;ethane (PubChem CID 178087768) has the molecular formula C9H16F2
and a molecular weight of 162.22 g/mol. Its IUPAC name is 5,5-difluorocycloheptene;ethane.
Molecular Properties
| Compound Name | 5,5-difluorocycloheptene;ethane |
| PubChem CID | 178087768 |
| Molecular Formula | C9H16F2 |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 5,5-difluorocycloheptene;ethane |
| SMILES | CC.FC1(F)CCC=CCC1 |
| InChI | InChI=1S/C7H10F2.C2H6/c8-7(9)5-3-1-2-4-6-7;1-2/h1-2H,3-6H2;1-2H3 |
| InChIKey | HGNKQZQNCWVLLO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluorocycloheptene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluorocycloheptene;ethane?
The IUPAC name of 5,5-difluorocycloheptene;ethane (CID 178087768) is 5,5-difluorocycloheptene;ethane.
What is the SMILES notation for 5,5-difluorocycloheptene;ethane?
The canonical SMILES for 5,5-difluorocycloheptene;ethane is CC.FC1(F)CCC=CCC1.
What is the InChIKey of 5,5-difluorocycloheptene;ethane?
The InChIKey is HGNKQZQNCWVLLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2.C2H6/c8-7(9)5-3-1-2-4-6-7;1-2/h1-2H,3-6H2;1-2H3.
What are the key properties of 5,5-difluorocycloheptene;ethane?
5,5-difluorocycloheptene;ethane has a molecular weight of 162.22 g/mol, XLogP of 3.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluorocycloheptene;ethane is sourced from PubChem (CID 178087768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).