C21H25BF3N3O4 — CID 178087992
methyl 5-[(2R)-3,3-difluoro-2-methylazetidin-1-yl]-1-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-3-carboxylate (PubChem CID 178087992) has the molecular formula C21H25BF3N3O4 and a molecular weight of 451.25 g/mol. Its IUPAC name is methyl 5-[(2R)-3,3-difluoro-2-methylazetidin-1-yl]-1-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-3-carboxylate.
| Compound Name | methyl 5-[(2R)-3,3-difluoro-2-methylazetidin-1-yl]-1-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 178087992 |
| Molecular Formula | C21H25BF3N3O4 |
| Molecular Weight | 451.25 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | methyl 5-[(2R)-3,3-difluoro-2-methylazetidin-1-yl]-1-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccc(F)cc2)c(N2CC(F)(F)[C@H]2C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H25BF3N3O4/c1-12-21(24,25)11-27(12)17-15(22-31-19(2,3)20(4,5)32-22)16(18(29)30-6)26-28(17)14-9-7-13(23)8-10-14/h7-10,12H,11H2,1-6H3/t12-/m1/s1 |
| InChIKey | PZHHWEGXNURARL-GFCCVEGCSA-N |
| XLogP | 2.94 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|