About ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde
ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde (PubChem CID 178087993) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde.
Molecular Properties
| Compound Name | ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde |
| PubChem CID | 178087993 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde |
| SMILES | C/C=C(\CC)C(=O)OCC.CC1CCCC1C=O |
| InChI | InChI=1S/C8H14O2.C7H12O/c1-4-7(5-2)8(9)10-6-3;1-6-3-2-4-7(6)5-8/h4H,5-6H2,1-3H3;5-7H,2-4H2,1H3/b7-4+; |
| InChIKey | OCMWMXLPNSILTF-KQGICBIGSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde?
The IUPAC name of ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde (CID 178087993) is ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde.
What is the SMILES notation for ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde?
The canonical SMILES for ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde is C/C=C(\CC)C(=O)OCC.CC1CCCC1C=O.
What is the InChIKey of ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde?
The InChIKey is OCMWMXLPNSILTF-KQGICBIGSA-N. The full InChI is InChI=1S/C8H14O2.C7H12O/c1-4-7(5-2)8(9)10-6-3;1-6-3-2-4-7(6)5-8/h4H,5-6H2,1-3H3;5-7H,2-4H2,1H3/b7-4+;.
What are the key properties of ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde?
ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde has a molecular weight of 254.37 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-ethylbut-2-enoate;2-methylcyclopentane-1-carbaldehyde is sourced from PubChem (CID 178087993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).