About methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate
methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate (PubChem CID 178088045) has the molecular formula C10H13F2NO4
and a molecular weight of 249.21 g/mol. Its IUPAC name is methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate.
Molecular Properties
| Compound Name | methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate |
| PubChem CID | 178088045 |
| Molecular Formula | C10H13F2NO4 |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)N1CC(F)(F)C[C@H]1C |
| InChI | InChI=1S/C10H13F2NO4/c1-6-4-10(11,12)5-13(6)8(15)3-7(14)9(16)17-2/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | GHAPNNJTDMNOIU-ZCFIWIBFSA-N |
| XLogP | 0.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate?
The IUPAC name of methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate (CID 178088045) is methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate.
What is the SMILES notation for methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate?
The canonical SMILES for methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate is COC(=O)C(=O)CC(=O)N1CC(F)(F)C[C@H]1C.
What is the InChIKey of methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate?
The InChIKey is GHAPNNJTDMNOIU-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H13F2NO4/c1-6-4-10(11,12)5-13(6)8(15)3-7(14)9(16)17-2/h6H,3-5H2,1-2H3/t6-/m1/s1.
What are the key properties of methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate?
methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate has a molecular weight of 249.21 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-2,4-dioxobutanoate is sourced from PubChem (CID 178088045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).