About 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene
2-ethenyl-3-methoxy-1,4-dimethylcyclohexene (PubChem CID 178088287) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene.
Molecular Properties
| Compound Name | 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene |
| PubChem CID | 178088287 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene |
| SMILES | C=CC1=C(C)CCC(C)C1OC |
| InChI | InChI=1S/C11H18O/c1-5-10-8(2)6-7-9(3)11(10)12-4/h5,9,11H,1,6-7H2,2-4H3 |
| InChIKey | LLQOJEPJDDIICK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene?
The IUPAC name of 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene (CID 178088287) is 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene.
What is the SMILES notation for 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene?
The canonical SMILES for 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene is C=CC1=C(C)CCC(C)C1OC.
What is the InChIKey of 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene?
The InChIKey is LLQOJEPJDDIICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-5-10-8(2)6-7-9(3)11(10)12-4/h5,9,11H,1,6-7H2,2-4H3.
What are the key properties of 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene?
2-ethenyl-3-methoxy-1,4-dimethylcyclohexene has a molecular weight of 166.26 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3-methoxy-1,4-dimethylcyclohexene is sourced from PubChem (CID 178088287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).