About 2,5-diphenyloxazine
2,5-diphenyloxazine (PubChem CID 178088498) has the molecular formula C16H13NO
and a molecular weight of 235.29 g/mol. Its IUPAC name is 2,5-diphenyloxazine.
Molecular Properties
| Compound Name | 2,5-diphenyloxazine |
| PubChem CID | 178088498 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2,5-diphenyloxazine |
| SMILES | C1=CN(c2ccccc2)OC=C1c1ccccc1 |
| InChI | InChI=1S/C16H13NO/c1-3-7-14(8-4-1)15-11-12-17(18-13-15)16-9-5-2-6-10-16/h1-13H |
| InChIKey | PFFSIQJHGYUJIP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-diphenyloxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenyloxazine?
The IUPAC name of 2,5-diphenyloxazine (CID 178088498) is 2,5-diphenyloxazine.
What is the SMILES notation for 2,5-diphenyloxazine?
The canonical SMILES for 2,5-diphenyloxazine is C1=CN(c2ccccc2)OC=C1c1ccccc1.
What is the InChIKey of 2,5-diphenyloxazine?
The InChIKey is PFFSIQJHGYUJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO/c1-3-7-14(8-4-1)15-11-12-17(18-13-15)16-9-5-2-6-10-16/h1-13H.
What are the key properties of 2,5-diphenyloxazine?
2,5-diphenyloxazine has a molecular weight of 235.29 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenyloxazine is sourced from PubChem (CID 178088498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).