C14H22BrFO2 — CID 178088950
(2E,4Z,6E)-2-bromo-5-(diethoxymethyl)-4-fluoronona-2,4,6-triene (PubChem CID 178088950) has the molecular formula C14H22BrFO2 and a molecular weight of 321.23 g/mol. Its IUPAC name is (2E,4Z,6E)-2-bromo-5-(diethoxymethyl)-4-fluoronona-2,4,6-triene.
| Compound Name | (2E,4Z,6E)-2-bromo-5-(diethoxymethyl)-4-fluoronona-2,4,6-triene |
|---|---|
| PubChem CID | 178088950 |
| Molecular Formula | C14H22BrFO2 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (2E,4Z,6E)-2-bromo-5-(diethoxymethyl)-4-fluoronona-2,4,6-triene |
| SMILES | CC/C=C/C(=C(F)\C=C(/C)Br)C(OCC)OCC |
| InChI | InChI=1S/C14H22BrFO2/c1-5-8-9-12(13(16)10-11(4)15)14(17-6-2)18-7-3/h8-10,14H,5-7H2,1-4H3/b9-8+,11-10+,13-12- |
| InChIKey | NXRDJICQWVLAMN-GUYOLSOBSA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|