About 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine
3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine (PubChem CID 178089540) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine |
| PubChem CID | 178089540 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine |
| SMILES | C/N=C1\C=CC=CC1=C(C)C.CCC(C)CC(CC)CC |
| InChI | InChI=1S/C10H13N.C10H22/c1-8(2)9-6-4-5-7-10(9)11-3;1-5-9(4)8-10(6-2)7-3/h4-7H,1-3H3;9-10H,5-8H2,1-4H3/b11-10+; |
| InChIKey | QINRAQBKDIDSMN-ASTDGNLGSA-N |
| XLogP | 6.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
The IUPAC name of 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine (CID 178089540) is 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
The canonical SMILES for 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine is C/N=C1\C=CC=CC1=C(C)C.CCC(C)CC(CC)CC.
What is the InChIKey of 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
The InChIKey is QINRAQBKDIDSMN-ASTDGNLGSA-N. The full InChI is InChI=1S/C10H13N.C10H22/c1-8(2)9-6-4-5-7-10(9)11-3;1-5-9(4)8-10(6-2)7-3/h4-7H,1-3H3;9-10H,5-8H2,1-4H3/b11-10+;.
What are the key properties of 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine?
3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine has a molecular weight of 289.51 g/mol, XLogP of 6.38, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-methylheptane;N-methyl-6-propan-2-ylidenecyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 178089540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).