C30H35F3N8O3 — CID 178090347
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-(2-methoxyethoxy)-5-[[4-[1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 178090347) has the molecular formula C30H35F3N8O3 and a molecular weight of 612.66 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-(2-methoxyethoxy)-5-[[4-[1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-(2-methoxyethoxy)-5-[[4-[1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 178090347 |
| Molecular Formula | C30H35F3N8O3 |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-(2-methoxyethoxy)-5-[[4-[1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3nc4ccccc4n3CC(F)(F)F)n2)c(OCCOC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C30H35F3N8O3/c1-6-27(42)35-22-17-23(26(44-16-15-43-5)18-25(22)40(4)14-13-39(2)3)38-29-34-12-11-21(37-29)28-36-20-9-7-8-10-24(20)41(28)19-30(31,32)33/h6-12,17-18H,1,13-16,19H2,2-5H3,(H,35,42)(H,34,37,38) |
| InChIKey | COUBQIJEHNFZGB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|