C23H38OSi — CID 178090504
trimethyl-[[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]methyl]silane (PubChem CID 178090504) has the molecular formula C23H38OSi and a molecular weight of 358.64 g/mol. Its IUPAC name is trimethyl-[[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]methyl]silane.
| Compound Name | trimethyl-[[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]methyl]silane |
|---|---|
| PubChem CID | 178090504 |
| Molecular Formula | C23H38OSi |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | trimethyl-[[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]methyl]silane |
| SMILES | CC(C)(C)OCCCCCCC1=CC(C[Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C23H38OSi/c1-23(2,3)24-16-12-8-7-9-13-19-17-20(18-25(4,5)6)22-15-11-10-14-21(19)22/h10-11,14-15,17,20H,7-9,12-13,16,18H2,1-6H3 |
| InChIKey | OSAZVPOZAZJLHW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|