C17H20F2N2O2 — CID 178091447
4-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-5-methoxyquinoline (PubChem CID 178091447) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.35 g/mol. Its IUPAC name is 4-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-5-methoxyquinoline.
| Compound Name | 4-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-5-methoxyquinoline |
|---|---|
| PubChem CID | 178091447 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-5-methoxyquinoline |
| SMILES | COc1cccc2nccc(CCN3CC[C@H](OC(F)F)C3)c12 |
| InChI | InChI=1S/C17H20F2N2O2/c1-22-15-4-2-3-14-16(15)12(5-8-20-14)6-9-21-10-7-13(11-21)23-17(18)19/h2-5,8,13,17H,6-7,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | COPJKPQYHCDVMS-ZDUSSCGKSA-N |
| XLogP | 3.10 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |