About 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole
2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole (PubChem CID 178091806) has the molecular formula C16H18F3N2O+
and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole.
Molecular Properties
| Compound Name | 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole |
| PubChem CID | 178091806 |
| Molecular Formula | C16H18F3N2O+ |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole |
| SMILES | Cc1[nH]c2cccc(OC(F)(F)F)c2c1CC1=[N+](C)CCC1 |
| InChI | InChI=1S/C16H18F3N2O/c1-10-12(9-11-5-4-8-21(11)2)15-13(20-10)6-3-7-14(15)22-16(17,18)19/h3,6-7,20H,4-5,8-9H2,1-2H3/q+1 |
| InChIKey | SXTPXTLIVVZXFP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 28.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole?
The IUPAC name of 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole (CID 178091806) is 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole.
What is the SMILES notation for 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole?
The canonical SMILES for 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole is Cc1[nH]c2cccc(OC(F)(F)F)c2c1CC1=[N+](C)CCC1.
What is the InChIKey of 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole?
The InChIKey is SXTPXTLIVVZXFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3N2O/c1-10-12(9-11-5-4-8-21(11)2)15-13(20-10)6-3-7-14(15)22-16(17,18)19/h3,6-7,20H,4-5,8-9H2,1-2H3/q+1.
What are the key properties of 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole?
2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole has a molecular weight of 311.33 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)methyl]-4-(trifluoromethoxy)-1H-indole is sourced from PubChem (CID 178091806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).