C23H26BF4N3O3 — CID 178092728
ethane;N-[2-fluoro-5-(trifluoromethyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 178092728) has the molecular formula C23H26BF4N3O3 and a molecular weight of 479.28 g/mol. Its IUPAC name is ethane;N-[2-fluoro-5-(trifluoromethyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | ethane;N-[2-fluoro-5-(trifluoromethyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 178092728 |
| Molecular Formula | C23H26BF4N3O3 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | ethane;N-[2-fluoro-5-(trifluoromethyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CC.CC1(C)OB(c2ccn3c(C(=O)Nc4cc(C(F)(F)F)ccc4F)cnc3c2)OC1(C)C |
| InChI | InChI=1S/C21H20BF4N3O3.C2H6/c1-19(2)20(3,4)32-22(31-19)13-7-8-29-16(11-27-17(29)10-13)18(30)28-15-9-12(21(24,25)26)5-6-14(15)23;1-2/h5-11H,1-4H3,(H,28,30);1-2H3 |
| InChIKey | WHXVCPMGUJRVSZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|