C24H33ClF3N3O2 — CID 178093408
2-chloro-N-(1-methylpiperidin-3-yl)-6-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine-4-carboxamide;ethane (PubChem CID 178093408) has the molecular formula C24H33ClF3N3O2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 2-chloro-N-(1-methylpiperidin-3-yl)-6-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine-4-carboxamide;ethane.
| Compound Name | 2-chloro-N-(1-methylpiperidin-3-yl)-6-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 178093408 |
| Molecular Formula | C24H33ClF3N3O2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-chloro-N-(1-methylpiperidin-3-yl)-6-[4-(2,2,2-trifluoroethoxy)phenyl]pyridine-4-carboxamide;ethane |
| SMILES | CC.CC.CN1CCCC(NC(=O)c2cc(Cl)nc(-c3ccc(OCC(F)(F)F)cc3)c2)C1 |
| InChI | InChI=1S/C20H21ClF3N3O2.2C2H6/c1-27-8-2-3-15(11-27)25-19(28)14-9-17(26-18(21)10-14)13-4-6-16(7-5-13)29-12-20(22,23)24;2*1-2/h4-7,9-10,15H,2-3,8,11-12H2,1H3,(H,25,28);2*1-2H3 |
| InChIKey | PSASKIRWIDWLJC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|