About [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate
[4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate (PubChem CID 178094819) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate.
Molecular Properties
| Compound Name | [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate |
| PubChem CID | 178094819 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate |
| SMILES | Cc1cc2ccc(-c3cnn(COC(=O)CC=O)c3)nc2n1C |
| InChI | InChI=1S/C16H16N4O3/c1-11-7-12-3-4-14(18-16(12)19(11)2)13-8-17-20(9-13)10-23-15(22)5-6-21/h3-4,6-9H,5,10H2,1-2H3 |
| InChIKey | HXFJFXYYXYIKSP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate?
The IUPAC name of [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate (CID 178094819) is [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate.
What is the SMILES notation for [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate?
The canonical SMILES for [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate is Cc1cc2ccc(-c3cnn(COC(=O)CC=O)c3)nc2n1C.
What is the InChIKey of [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate?
The InChIKey is HXFJFXYYXYIKSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3/c1-11-7-12-3-4-14(18-16(12)19(11)2)13-8-17-20(9-13)10-23-15(22)5-6-21/h3-4,6-9H,5,10H2,1-2H3.
What are the key properties of [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate?
[4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate has a molecular weight of 312.33 g/mol, XLogP of 1.83, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2-dimethylpyrrolo[2,3-b]pyridin-6-yl)pyrazol-1-yl]methyl 3-oxopropanoate is sourced from PubChem (CID 178094819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).