About 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane
5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane (PubChem CID 178095598) has the molecular formula C13H20F2N2O
and a molecular weight of 258.31 g/mol. Its IUPAC name is 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane.
Molecular Properties
| Compound Name | 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane |
| PubChem CID | 178095598 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane |
| SMILES | CC.CC.COc1c(F)cc2c(C)[nH]nc2c1F |
| InChI | InChI=1S/C9H8F2N2O.2C2H6/c1-4-5-3-6(10)9(14-2)7(11)8(5)13-12-4;2*1-2/h3H,1-2H3,(H,12,13);2*1-2H3 |
| InChIKey | AJWUHQTYBLHSRO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane?
The IUPAC name of 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane (CID 178095598) is 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane.
What is the SMILES notation for 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane?
The canonical SMILES for 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane is CC.CC.COc1c(F)cc2c(C)[nH]nc2c1F.
What is the InChIKey of 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane?
The InChIKey is AJWUHQTYBLHSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N2O.2C2H6/c1-4-5-3-6(10)9(14-2)7(11)8(5)13-12-4;2*1-2/h3H,1-2H3,(H,12,13);2*1-2H3.
What are the key properties of 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane?
5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane has a molecular weight of 258.31 g/mol, XLogP of 4.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-6-methoxy-3-methyl-2H-indazole;ethane is sourced from PubChem (CID 178095598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).