C6H7AtFN3O2 — CID 178095652
[5-(2-amino-2-carboxyethyl)-4-fluoro-1H-pyrazol-3-yl]astatine (PubChem CID 178095652) has the molecular formula C6H7AtFN3O2 and a molecular weight of 382.14 g/mol. Its IUPAC name is [5-(2-amino-2-carboxyethyl)-4-fluoro-1H-pyrazol-3-yl]astatine.
| Compound Name | [5-(2-amino-2-carboxyethyl)-4-fluoro-1H-pyrazol-3-yl]astatine |
|---|---|
| PubChem CID | 178095652 |
| Molecular Formula | C6H7AtFN3O2 |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [5-(2-amino-2-carboxyethyl)-4-fluoro-1H-pyrazol-3-yl]astatine |
| SMILES | NC(Cc1[nH]nc([At])c1F)C(=O)O |
| InChI | InChI=1S/C6H7AtFN3O2/c7-5-4(8)3(10-11-5)1-2(9)6(12)13/h2H,1,9H2,(H,10,11)(H,12,13) |
| InChIKey | SIMKXCGKEZKHGF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |