C20H23FN4O2 — CID 178096352
4-[4-[2-(4-cyclopropyl-3-fluorophenyl)acetyl]piperazin-1-yl]-1-methylpyrimidin-2-one (PubChem CID 178096352) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-[4-[2-(4-cyclopropyl-3-fluorophenyl)acetyl]piperazin-1-yl]-1-methylpyrimidin-2-one.
| Compound Name | 4-[4-[2-(4-cyclopropyl-3-fluorophenyl)acetyl]piperazin-1-yl]-1-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 178096352 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 4-[4-[2-(4-cyclopropyl-3-fluorophenyl)acetyl]piperazin-1-yl]-1-methylpyrimidin-2-one |
| SMILES | Cn1ccc(N2CCN(C(=O)Cc3ccc(C4CC4)c(F)c3)CC2)nc1=O |
| InChI | InChI=1S/C20H23FN4O2/c1-23-7-6-18(22-20(23)27)24-8-10-25(11-9-24)19(26)13-14-2-5-16(15-3-4-15)17(21)12-14/h2,5-7,12,15H,3-4,8-11,13H2,1H3 |
| InChIKey | AQDOZYWVAYEERN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |