About [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene
[2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene (PubChem CID 178096628) has the molecular formula C16H16N2O
and a molecular weight of 252.32 g/mol. Its IUPAC name is [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene.
Molecular Properties
| Compound Name | [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene |
| PubChem CID | 178096628 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene |
| SMILES | [H]/N=N/C(C[C@H]1CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c17-18-16(11-15-12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2/b18-17+/t15-/m0/s1 |
| InChIKey | JGKJIKIKIMVXEH-HEWTWTGNSA-N |
| XLogP | 3.75 |
| TPSA | 48.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene?
The IUPAC name of [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene (CID 178096628) is [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene.
What is the SMILES notation for [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene?
The canonical SMILES for [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene is [H]/N=N/C(C[C@H]1CO1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene?
The InChIKey is JGKJIKIKIMVXEH-HEWTWTGNSA-N. The full InChI is InChI=1S/C16H16N2O/c17-18-16(11-15-12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2/b18-17+/t15-/m0/s1.
What are the key properties of [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene?
[2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene has a molecular weight of 252.32 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2S)-oxiran-2-yl]-1,1-diphenylethyl]diazene is sourced from PubChem (CID 178096628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).