C16H29NO3 — CID 178096629
methyl (1S,2S,3R)-2-ethyl-2,3-dimethylcyclopentane-1-carboxylate;pyrrolidine-1-carbaldehyde (PubChem CID 178096629) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is methyl (1S,2S,3R)-2-ethyl-2,3-dimethylcyclopentane-1-carboxylate;pyrrolidine-1-carbaldehyde.
| Compound Name | methyl (1S,2S,3R)-2-ethyl-2,3-dimethylcyclopentane-1-carboxylate;pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 178096629 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | methyl (1S,2S,3R)-2-ethyl-2,3-dimethylcyclopentane-1-carboxylate;pyrrolidine-1-carbaldehyde |
| SMILES | CC[C@@]1(C)[C@H](C)CC[C@@H]1C(=O)OC.O=CN1CCCC1 |
| InChI | InChI=1S/C11H20O2.C5H9NO/c1-5-11(3)8(2)6-7-9(11)10(12)13-4;7-5-6-3-1-2-4-6/h8-9H,5-7H2,1-4H3;5H,1-4H2/t8-,9-,11+;/m1./s1 |
| InChIKey | OPAXEMMGAMZSDL-DDLFKVEVSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|