About [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene
[2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene (PubChem CID 178096638) has the molecular formula C18H14F6N2O
and a molecular weight of 388.31 g/mol. Its IUPAC name is [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene.
Molecular Properties
| Compound Name | [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene |
| PubChem CID | 178096638 |
| Molecular Formula | C18H14F6N2O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene |
| SMILES | [H]/N=N/C(C[C@H]1CO1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F6N2O/c19-17(20,21)13-5-1-11(2-6-13)16(26-25,9-15-10-27-15)12-3-7-14(8-4-12)18(22,23)24/h1-8,15,25H,9-10H2/b26-25+/t15-/m0/s1 |
| InChIKey | IZFGHWGDAIZANR-RZJDRKADSA-N |
| XLogP | 5.79 |
| TPSA | 48.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene?
The IUPAC name of [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene (CID 178096638) is [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene.
What is the SMILES notation for [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene?
The canonical SMILES for [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene is [H]/N=N/C(C[C@H]1CO1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene?
The InChIKey is IZFGHWGDAIZANR-RZJDRKADSA-N. The full InChI is InChI=1S/C18H14F6N2O/c19-17(20,21)13-5-1-11(2-6-13)16(26-25,9-15-10-27-15)12-3-7-14(8-4-12)18(22,23)24/h1-8,15,25H,9-10H2/b26-25+/t15-/m0/s1.
What are the key properties of [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene?
[2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene has a molecular weight of 388.31 g/mol, XLogP of 5.79, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2S)-oxiran-2-yl]-1,1-bis[4-(trifluoromethyl)phenyl]ethyl]diazene is sourced from PubChem (CID 178096638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).