C24H25F3N2O4 — CID 178097533
tert-butyl 4-[1-[2-methyl-4-oxo-7-(trifluoromethyl)-3H-quinazolin-6-yl]propoxy]benzoate (PubChem CID 178097533) has the molecular formula C24H25F3N2O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is tert-butyl 4-[1-[2-methyl-4-oxo-7-(trifluoromethyl)-3H-quinazolin-6-yl]propoxy]benzoate.
| Compound Name | tert-butyl 4-[1-[2-methyl-4-oxo-7-(trifluoromethyl)-3H-quinazolin-6-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 178097533 |
| Molecular Formula | C24H25F3N2O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | tert-butyl 4-[1-[2-methyl-4-oxo-7-(trifluoromethyl)-3H-quinazolin-6-yl]propoxy]benzoate |
| SMILES | CCC(Oc1ccc(C(=O)OC(C)(C)C)cc1)c1cc2c(=O)[nH]c(C)nc2cc1C(F)(F)F |
| InChI | InChI=1S/C24H25F3N2O4/c1-6-20(32-15-9-7-14(8-10-15)22(31)33-23(3,4)5)16-11-17-19(12-18(16)24(25,26)27)28-13(2)29-21(17)30/h7-12,20H,6H2,1-5H3,(H,28,29,30) |
| InChIKey | VRZOWNHJCJXKBV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |