C23H22ClF3N4O3 — CID 178098836
1-[2-chloro-3-[4-[[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]methyl]phenyl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 178098836) has the molecular formula C23H22ClF3N4O3 and a molecular weight of 494.90 g/mol. Its IUPAC name is 1-[2-chloro-3-[4-[[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]methyl]phenyl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-chloro-3-[4-[[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]methyl]phenyl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178098836 |
| Molecular Formula | C23H22ClF3N4O3 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 1-[2-chloro-3-[4-[[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]methyl]phenyl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cccc(-c3ccc(CN4CCCN(CC(F)(F)F)C4=O)cc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C23H22ClF3N4O3/c24-20-17(3-1-4-18(20)31-12-9-19(32)28-21(31)33)16-7-5-15(6-8-16)13-29-10-2-11-30(22(29)34)14-23(25,26)27/h1,3-8H,2,9-14H2,(H,28,32,33) |
| InChIKey | MMCOCYVHIRVXRL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |