C13H19NO2 — CID 178098892
1-[(1-methoxycyclopropyl)methyl]-3-propan-2-ylpyridin-2-one (PubChem CID 178098892) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-[(1-methoxycyclopropyl)methyl]-3-propan-2-ylpyridin-2-one.
| Compound Name | 1-[(1-methoxycyclopropyl)methyl]-3-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 178098892 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-[(1-methoxycyclopropyl)methyl]-3-propan-2-ylpyridin-2-one |
| SMILES | COC1(Cn2cccc(C(C)C)c2=O)CC1 |
| InChI | InChI=1S/C13H19NO2/c1-10(2)11-5-4-8-14(12(11)15)9-13(16-3)6-7-13/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | MNIVEXYCXLSYRH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |