About (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one
(4R)-1-ethyl-3,4-dimethylimidazolidin-2-one (PubChem CID 178098960) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one |
| PubChem CID | 178098960 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one |
| SMILES | CCN1C[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C7H14N2O/c1-4-9-5-6(2)8(3)7(9)10/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | OZACAQQZOKRHFM-ZCFIWIBFSA-N |
| XLogP | 0.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one?
The IUPAC name of (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one (CID 178098960) is (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one.
What is the SMILES notation for (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one?
The canonical SMILES for (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one is CCN1C[C@@H](C)N(C)C1=O.
What is the InChIKey of (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one?
The InChIKey is OZACAQQZOKRHFM-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H14N2O/c1-4-9-5-6(2)8(3)7(9)10/h6H,4-5H2,1-3H3/t6-/m1/s1.
What are the key properties of (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one?
(4R)-1-ethyl-3,4-dimethylimidazolidin-2-one has a molecular weight of 142.20 g/mol, XLogP of 0.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-ethyl-3,4-dimethylimidazolidin-2-one is sourced from PubChem (CID 178098960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).