About ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one
ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one (PubChem CID 178099023) has the molecular formula C10H14F3NO
and a molecular weight of 221.22 g/mol. Its IUPAC name is ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one.
Molecular Properties
| Compound Name | ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one |
| PubChem CID | 178099023 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one |
| SMILES | CC.Cc1cccn(CC(F)(F)F)c1=O |
| InChI | InChI=1S/C8H8F3NO.C2H6/c1-6-3-2-4-12(7(6)13)5-8(9,10)11;1-2/h2-4H,5H2,1H3;1-2H3 |
| InChIKey | FWXOVWOGYVOBKS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one?
The IUPAC name of ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one (CID 178099023) is ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one.
What is the SMILES notation for ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one?
The canonical SMILES for ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one is CC.Cc1cccn(CC(F)(F)F)c1=O.
What is the InChIKey of ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one?
The InChIKey is FWXOVWOGYVOBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO.C2H6/c1-6-3-2-4-12(7(6)13)5-8(9,10)11;1-2/h2-4H,5H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one?
ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one has a molecular weight of 221.22 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1-(2,2,2-trifluoroethyl)pyridin-2-one is sourced from PubChem (CID 178099023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).