C21H19ClN4O3S — CID 178099066
1-[2-chloro-3-[4-(7-oxo-5-thia-6,8-diazaspiro[3.4]octan-8-yl)phenyl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 178099066) has the molecular formula C21H19ClN4O3S and a molecular weight of 442.93 g/mol. Its IUPAC name is 1-[2-chloro-3-[4-(7-oxo-5-thia-6,8-diazaspiro[3.4]octan-8-yl)phenyl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-chloro-3-[4-(7-oxo-5-thia-6,8-diazaspiro[3.4]octan-8-yl)phenyl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178099066 |
| Molecular Formula | C21H19ClN4O3S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-[2-chloro-3-[4-(7-oxo-5-thia-6,8-diazaspiro[3.4]octan-8-yl)phenyl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cccc(-c3ccc(N4C(=O)NSC45CCC5)cc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C21H19ClN4O3S/c22-18-15(3-1-4-16(18)25-12-9-17(27)23-19(25)28)13-5-7-14(8-6-13)26-20(29)24-30-21(26)10-2-11-21/h1,3-8H,2,9-12H2,(H,24,29)(H,23,27,28) |
| InChIKey | NWZLSIWYHPSFKN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|