C22H20ClF3N4O3 — CID 178099075
1-[2-chloro-3-[4-[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]phenyl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 178099075) has the molecular formula C22H20ClF3N4O3 and a molecular weight of 480.87 g/mol. Its IUPAC name is 1-[2-chloro-3-[4-[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]phenyl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-chloro-3-[4-[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]phenyl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178099075 |
| Molecular Formula | C22H20ClF3N4O3 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-[2-chloro-3-[4-[2-oxo-3-(2,2,2-trifluoroethyl)-1,3-diazinan-1-yl]phenyl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cccc(-c3ccc(N4CCCN(CC(F)(F)F)C4=O)cc3)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C22H20ClF3N4O3/c23-19-16(3-1-4-17(19)30-12-9-18(31)27-20(30)32)14-5-7-15(8-6-14)29-11-2-10-28(21(29)33)13-22(24,25)26/h1,3-8H,2,9-13H2,(H,27,31,32) |
| InChIKey | ODMDQMROUZOCBU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |