About 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one
3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one (PubChem CID 178099450) has the molecular formula C11H14F3NO
and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one.
Molecular Properties
| Compound Name | 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one |
| PubChem CID | 178099450 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one |
| SMILES | CCC(C)c1cc(F)cn(CC(F)F)c1=O |
| InChI | InChI=1S/C11H14F3NO/c1-3-7(2)9-4-8(12)5-15(11(9)16)6-10(13)14/h4-5,7,10H,3,6H2,1-2H3 |
| InChIKey | XEGLBDSRIDNHRV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one?
The IUPAC name of 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one (CID 178099450) is 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one.
What is the SMILES notation for 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one?
The canonical SMILES for 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one is CCC(C)c1cc(F)cn(CC(F)F)c1=O.
What is the InChIKey of 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one?
The InChIKey is XEGLBDSRIDNHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO/c1-3-7(2)9-4-8(12)5-15(11(9)16)6-10(13)14/h4-5,7,10H,3,6H2,1-2H3.
What are the key properties of 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one?
3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one has a molecular weight of 233.23 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-1-(2,2-difluoroethyl)-5-fluoropyridin-2-one is sourced from PubChem (CID 178099450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).