About 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one
2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one (PubChem CID 178099996) has the molecular formula C18H29N5O3
and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one.
Molecular Properties
| Compound Name | 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one |
| PubChem CID | 178099996 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one |
| SMILES | CCCCOc1ncc2[nH]c(=O)n(CCCN3C(C)COCC3C)c2n1 |
| InChI | InChI=1S/C18H29N5O3/c1-4-5-9-26-17-19-10-15-16(21-17)23(18(24)20-15)8-6-7-22-13(2)11-25-12-14(22)3/h10,13-14H,4-9,11-12H2,1-3H3,(H,20,24) |
| InChIKey | XKEGEYNDLOQGHE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one?
The IUPAC name of 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one (CID 178099996) is 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one.
What is the SMILES notation for 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one?
The canonical SMILES for 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one is CCCCOc1ncc2[nH]c(=O)n(CCCN3C(C)COCC3C)c2n1.
What is the InChIKey of 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one?
The InChIKey is XKEGEYNDLOQGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N5O3/c1-4-5-9-26-17-19-10-15-16(21-17)23(18(24)20-15)8-6-7-22-13(2)11-25-12-14(22)3/h10,13-14H,4-9,11-12H2,1-3H3,(H,20,24).
What are the key properties of 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one?
2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one has a molecular weight of 363.46 g/mol, XLogP of 1.80, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-9-[3-(3,5-dimethylmorpholin-4-yl)propyl]-7H-purin-8-one is sourced from PubChem (CID 178099996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).